CAS 2761170-84-5 appears in our catalog under these names: 3-(5-(Aminomethyl)-6-fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, ABS-752. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5 mg, 25 mg, 10 mg.
3-[6-(aminomethyl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2761170-84-5) is a chemical compound with the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. IUPAC name: 3-[6-(aminomethyl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: VHUZYSKPEQGBJP-UHFFFAOYSA-N.
| Molecular formula | C14H14FN3O3 |
|---|---|
| Molecular weight | 291.28 g/mol |
| IUPAC name | 3-[6-(aminomethyl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | VHUZYSKPEQGBJP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=CC(=C(C=C3C2=O)F)CN |
Computed by PubChem (NCBI)