CAS 2761212-93-3 is the registry number for 5-Ethynyl-6-fluoro-2-methylbenzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-ethynyl-6-fluoro-2-methyl-1,3-benzothiazole (CAS 2761212-93-3) is a chemical compound with the molecular formula C10H6FNS and a molecular weight of 191.23 g/mol. IUPAC name: 5-ethynyl-6-fluoro-2-methyl-1,3-benzothiazole. InChIKey: VBZCCFSYUUYEBK-UHFFFAOYSA-N.
| Molecular formula | C10H6FNS |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 5-ethynyl-6-fluoro-2-methyl-1,3-benzothiazole |
| InChIKey | VBZCCFSYUUYEBK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C(=C2)C#C)F |
Computed by PubChem (NCBI)