Products 2761296-40-4

CAS 2761296-40-4 is the registry number for 6-Chloro-3-nitro-5-(trifluoromethyl)picolinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-chloro-3-nitro-5-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 2761296-40-4) is a chemical compound with the molecular formula C7H2ClF3N2O4 and a molecular weight of 270.55 g/mol. IUPAC name: 6-chloro-3-nitro-5-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: RPUXBHZEVJHCGR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2ClF3N2O4
Molecular weight270.55 g/mol
IUPAC name6-chloro-3-nitro-5-(trifluoromethyl)pyridine-2-carboxylic acid
InChIKeyRPUXBHZEVJHCGR-UHFFFAOYSA-N
SMILESC1=C(C(=NC(=C1[N+](=O)[O-])C(=O)O)Cl)C(F)(F)F

Computed by PubChem (NCBI)