CAS 2761321-26-8 appears in our catalog under these names: BRD4-BD1-IN-2, 98%, BRD4-BD1-IN-2/ 99.47% (existing batch purity), 8-Bromo-1,7-bis[(4-bromophenyl)methyl]-3,7-dihydro-3-methyl-1H-purine-2,6-dione, 95%, 95%, BRD4-BD1-IN-2. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 5 mg.
8-bromo-1,7-bis[(4-bromophenyl)methyl]-3-methylpurine-2,6-dione (CAS 2761321-26-8) is a chemical compound with the molecular formula C20H15Br3N4O2 and a molecular weight of 583.1 g/mol. IUPAC name: 8-bromo-1,7-bis[(4-bromophenyl)methyl]-3-methylpurine-2,6-dione. InChIKey: OPAIYDQJAQCNOX-UHFFFAOYSA-N.
| Molecular formula | C20H15Br3N4O2 |
|---|---|
| Molecular weight | 583.1 g/mol |
| IUPAC name | 8-bromo-1,7-bis[(4-bromophenyl)methyl]-3-methylpurine-2,6-dione |
| InChIKey | OPAIYDQJAQCNOX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)CC3=CC=C(C=C3)Br)N(C(=N2)Br)CC4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)