Products 2761577-50-6
CAS 2761577-50-6 is the registry number for Anti-osteoporosis agent-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2,2-dimethylchromen-7-ol (CAS 2761577-50-6) is a chemical compound with the molecular formula C20H19ClN2O2 and a molecular weight of 354.8 g/mol. IUPAC name: 8-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2,2-dimethylchromen-7-ol. InChIKey: ZXGCKXYHNYMBSZ-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN2O2 |
|---|---|
| Molecular weight | 354.8 g/mol |
| IUPAC name | 8-[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2,2-dimethylchromen-7-ol |
| InChIKey | ZXGCKXYHNYMBSZ-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C(=C(C=C2)O)C3=NNC(C3)C4=CC=C(C=C4)Cl)C |
Computed by PubChem (NCBI)
Synonyms:
Anti-osteoporosis agent-1, orb1688768