Products 2761768-49-2
CAS 2761768-49-2 is the registry number for 2-Amino-6-(1,1-difluoroethyl)pyrimidin-4(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-4-(1,1-difluoroethyl)-1H-pyrimidin-6-one (CAS 2761768-49-2) is a chemical compound with the molecular formula C6H7F2N3O and a molecular weight of 175.14 g/mol. IUPAC name: 2-amino-4-(1,1-difluoroethyl)-1H-pyrimidin-6-one. InChIKey: DIBBALAXPLWIAU-UHFFFAOYSA-N.
| Molecular formula | C6H7F2N3O |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 2-amino-4-(1,1-difluoroethyl)-1H-pyrimidin-6-one |
| InChIKey | DIBBALAXPLWIAU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=O)NC(=N1)N)(F)F |
Computed by PubChem (NCBI)