CAS 2762405-17-2 appears in our catalog under these names: NADPH oxidase–IN–1, NADPH oxidase-IN-1, 99%, 99%, NADPH oxidase-IN-1, 99.69%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 25 mg, 10 mg, 100 mg, 50 mg.
(5E)-3-cyclohexyl-5-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one (CAS 2762405-17-2) is a chemical compound with the molecular formula C20H27N3O2S and a molecular weight of 373.5 g/mol. IUPAC name: (5E)-3-cyclohexyl-5-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one. InChIKey: ZRIXYNJXSCQFPE-NBVRZTHBSA-N.
| Molecular formula | C20H27N3O2S |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | (5E)-3-cyclohexyl-5-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
| InChIKey | ZRIXYNJXSCQFPE-NBVRZTHBSA-N |
| SMILES | CN1/C(=C/C2=CC=C(C=C2)N(C)CCO)/C(=O)N(C1=S)C3CCCCC3 |
Computed by PubChem (NCBI)