CAS 2762552-73-6 appears in our catalog under these names: (E)-4-((4-(5-Nitrofuran-2-carboxamido)phenyl)amino)-4-oxobut-2-enoic acid, 98%, STING ligand-3, 99.21%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 10 mg, 25 mg, 50 mg, 100 mg, 5 mg.
(E)-4-[4-[(5-nitrofuran-2-carbonyl)amino]anilino]-4-oxobut-2-enoic acid (CAS 2762552-73-6) is a chemical compound with the molecular formula C15H11N3O7 and a molecular weight of 345.26 g/mol. IUPAC name: (E)-4-[4-[(5-nitrofuran-2-carbonyl)amino]anilino]-4-oxobut-2-enoic acid. InChIKey: XLSAZGWBJUXGFM-SOFGYWHQSA-N.
| Molecular formula | C15H11N3O7 |
|---|---|
| Molecular weight | 345.26 g/mol |
| IUPAC name | (E)-4-[4-[(5-nitrofuran-2-carbonyl)amino]anilino]-4-oxobut-2-enoic acid |
| InChIKey | XLSAZGWBJUXGFM-SOFGYWHQSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)/C=C/C(=O)O)NC(=O)C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)