CAS 2762571-32-2 is the registry number for Antitumor agent-148. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[2-(2-chlorophenyl)propan-2-yloxy]phenyl]pyridine-3-carboxamide (CAS 2762571-32-2) is a chemical compound with the molecular formula C21H19ClN2O2 and a molecular weight of 366.8 g/mol. IUPAC name: N-[4-[2-(2-chlorophenyl)propan-2-yloxy]phenyl]pyridine-3-carboxamide. InChIKey: UZACGPWOBLYCLU-UHFFFAOYSA-N.
| Molecular formula | C21H19ClN2O2 |
|---|---|
| Molecular weight | 366.8 g/mol |
| IUPAC name | N-[4-[2-(2-chlorophenyl)propan-2-yloxy]phenyl]pyridine-3-carboxamide |
| InChIKey | UZACGPWOBLYCLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1Cl)OC2=CC=C(C=C2)NC(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)