CAS 2762727-93-3 is the registry number for tert-Butyl 6-fluorochromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-fluoro-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2762727-93-3) is a chemical compound with the molecular formula C14H17FO3 and a molecular weight of 252.28 g/mol. IUPAC name: tert-butyl 6-fluoro-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: OSDAMYJFIBWNAJ-UHFFFAOYSA-N.
| Molecular formula | C14H17FO3 |
|---|---|
| Molecular weight | 252.28 g/mol |
| IUPAC name | tert-butyl 6-fluoro-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | OSDAMYJFIBWNAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC2=C(C=CC(=C2)F)OC1 |
Computed by PubChem (NCBI)