CAS 2763157-97-5 is the registry number for 6,8-Dichloro-3-methoxypyrimido[5,4-c]pyridazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-3-methoxypyrimido[5,4-c]pyridazine (CAS 2763157-97-5) is a chemical compound with the molecular formula C7H4Cl2N4O and a molecular weight of 231.04 g/mol. IUPAC name: 6,8-dichloro-3-methoxypyrimido[5,4-c]pyridazine. InChIKey: HLWRCAJZLQJHOI-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N4O |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 6,8-dichloro-3-methoxypyrimido[5,4-c]pyridazine |
| InChIKey | HLWRCAJZLQJHOI-UHFFFAOYSA-N |
| SMILES | COC1=NN=C2C(=C1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)