CAS 2763160-39-8 is the registry number for Rel-(1R,5S,8s)-8-((tert-butyldiphenylsilyl)oxy)-3-azabicyclo[3.2.1]octane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,5R)-3-azabicyclo[3.2.1]octan-8-yl]oxy-tert-butyl-diphenylsilane (CAS 2763160-39-8) is a chemical compound with the molecular formula C23H31NOSi and a molecular weight of 365.6 g/mol. IUPAC name: [(1S,5R)-3-azabicyclo[3.2.1]octan-8-yl]oxy-tert-butyl-diphenylsilane. InChIKey: NLXHNONGZGXHBL-QIDMFYOTSA-N.
| Molecular formula | C23H31NOSi |
|---|---|
| Molecular weight | 365.6 g/mol |
| IUPAC name | [(1S,5R)-3-azabicyclo[3.2.1]octan-8-yl]oxy-tert-butyl-diphenylsilane |
| InChIKey | NLXHNONGZGXHBL-QIDMFYOTSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OC3[C@@H]4CC[C@H]3CNC4 |
Computed by PubChem (NCBI)