CAS 2763220-83-1 is the registry number for 6- ChloroPsilocybin. Offered by: TRC. Available pack sizes: 250mg.
[6-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] dihydrogen phosphate (CAS 2763220-83-1) is a chemical compound with the molecular formula C12H16ClN2O4P and a molecular weight of 318.69 g/mol. IUPAC name: [6-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] dihydrogen phosphate. InChIKey: HEGJTGWWYBERDW-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN2O4P |
|---|---|
| Molecular weight | 318.69 g/mol |
| IUPAC name | [6-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] dihydrogen phosphate |
| InChIKey | HEGJTGWWYBERDW-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C(=CC(=C2)Cl)OP(=O)(O)O |
Computed by PubChem (NCBI)