Products 2763220-83-1

CAS 2763220-83-1 is the registry number for 6- ChloroPsilocybin. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

[6-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] dihydrogen phosphate (CAS 2763220-83-1) is a chemical compound with the molecular formula C12H16ClN2O4P and a molecular weight of 318.69 g/mol. IUPAC name: [6-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] dihydrogen phosphate. InChIKey: HEGJTGWWYBERDW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16ClN2O4P
Molecular weight318.69 g/mol
IUPAC name[6-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] dihydrogen phosphate
InChIKeyHEGJTGWWYBERDW-UHFFFAOYSA-N
SMILESCN(C)CCC1=CNC2=C1C(=CC(=C2)Cl)OP(=O)(O)O

Computed by PubChem (NCBI)