CAS 2763226-49-7 is the registry number for SIOC-XJC-SF02. Offered by: MedChemExpress. Available pack sizes: Get quote.
Propan-2-yl 2-[4-[4-[(E)-2-fluorosulfonylethenyl]benzoyl]phenoxy]-2-methylpropanoate (CAS 2763226-49-7) is a chemical compound with the molecular formula C22H23FO6S and a molecular weight of 434.5 g/mol. IUPAC name: propan-2-yl 2-[4-[4-[(E)-2-fluorosulfonylethenyl]benzoyl]phenoxy]-2-methylpropanoate. InChIKey: IPLIFZMFIWDWOH-BUHFOSPRSA-N.
| Molecular formula | C22H23FO6S |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | propan-2-yl 2-[4-[4-[(E)-2-fluorosulfonylethenyl]benzoyl]phenoxy]-2-methylpropanoate |
| InChIKey | IPLIFZMFIWDWOH-BUHFOSPRSA-N |
| SMILES | CC(C)OC(=O)C(C)(C)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)/C=C/S(=O)(=O)F |
Computed by PubChem (NCBI)