CAS 2763329-68-4 is the registry number for (4-Bromo-2-(methylamino)phenyl)dimethylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-dimethylphosphoryl-N-methylaniline (CAS 2763329-68-4) is a chemical compound with the molecular formula C9H13BrNOP and a molecular weight of 262.08 g/mol. IUPAC name: 5-bromo-2-dimethylphosphoryl-N-methylaniline. InChIKey: MWFAFTWMBWZJDC-UHFFFAOYSA-N.
| Molecular formula | C9H13BrNOP |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | 5-bromo-2-dimethylphosphoryl-N-methylaniline |
| InChIKey | MWFAFTWMBWZJDC-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=CC(=C1)Br)P(=O)(C)C |
Computed by PubChem (NCBI)