Products 2763979-06-0
CAS 2763979-06-0 is the registry number for 1-(6-(Trifluoromethyl)pyridin-3-yl)azepan-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-[6-(trifluoromethyl)-3-pyridinyl]azepan-2-one (CAS 2763979-06-0) is a chemical compound with the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. IUPAC name: 1-[6-(trifluoromethyl)-3-pyridinyl]azepan-2-one. InChIKey: NICFRCUEOOALOS-UHFFFAOYSA-N.
| Molecular formula | C12H13F3N2O |
|---|---|
| Molecular weight | 258.24 g/mol |
| IUPAC name | 1-[6-(trifluoromethyl)-3-pyridinyl]azepan-2-one |
| InChIKey | NICFRCUEOOALOS-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)N(CC1)C2=CN=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)