Products 2764728-59-6
CAS 2764728-59-6 is the registry number for (2,4-Dibromo-6-fluorophenyl)(pyrrolidin-1-yl)methanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(2,4-dibromo-6-fluorophenyl)-pyrrolidin-1-ylmethanone (CAS 2764728-59-6) is a chemical compound with the molecular formula C11H10Br2FNO and a molecular weight of 351.01 g/mol. IUPAC name: (2,4-dibromo-6-fluorophenyl)-pyrrolidin-1-ylmethanone. InChIKey: MPUKRRYRBHPILY-UHFFFAOYSA-N.
| Molecular formula | C11H10Br2FNO |
|---|---|
| Molecular weight | 351.01 g/mol |
| IUPAC name | (2,4-dibromo-6-fluorophenyl)-pyrrolidin-1-ylmethanone |
| InChIKey | MPUKRRYRBHPILY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=C(C=C(C=C2Br)Br)F |
Computed by PubChem (NCBI)