CAS 2764729-11-3 is the registry number for 2-(Benzyloxy)-1,5-dibromo-3-(trifluoromethoxy)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,5-dibromo-2-phenylmethoxy-3-(trifluoromethoxy)benzene (CAS 2764729-11-3) is a chemical compound with the molecular formula C14H9Br2F3O2 and a molecular weight of 426.02 g/mol. IUPAC name: 1,5-dibromo-2-phenylmethoxy-3-(trifluoromethoxy)benzene. InChIKey: CABHPDDUSWFOCO-UHFFFAOYSA-N.
| Molecular formula | C14H9Br2F3O2 |
|---|---|
| Molecular weight | 426.02 g/mol |
| IUPAC name | 1,5-dibromo-2-phenylmethoxy-3-(trifluoromethoxy)benzene |
| InChIKey | CABHPDDUSWFOCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)Br)OC(F)(F)F |
Computed by PubChem (NCBI)