CAS 2764729-38-4 is the registry number for 1-Chloro-3-fluoro-2-iodo-4-(methoxymethoxy)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-chloro-3-fluoro-2-iodo-4-(methoxymethoxy)benzene (CAS 2764729-38-4) is a chemical compound with the molecular formula C8H7ClFIO2 and a molecular weight of 316.49 g/mol. IUPAC name: 1-chloro-3-fluoro-2-iodo-4-(methoxymethoxy)benzene. InChIKey: BLBNTLONPRLREE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFIO2 |
|---|---|
| Molecular weight | 316.49 g/mol |
| IUPAC name | 1-chloro-3-fluoro-2-iodo-4-(methoxymethoxy)benzene |
| InChIKey | BLBNTLONPRLREE-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)Cl)I)F |
Computed by PubChem (NCBI)