Products 2764731-79-3
CAS 2764731-79-3 is the registry number for 1-(2,4-Dichloro-5-methylphenyl)-2,2,2-trifluoroethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(2,4-dichloro-5-methylphenyl)-2,2,2-trifluoroethanone (CAS 2764731-79-3) is a chemical compound with the molecular formula C9H5Cl2F3O and a molecular weight of 257.03 g/mol. IUPAC name: 1-(2,4-dichloro-5-methylphenyl)-2,2,2-trifluoroethanone. InChIKey: DKCAIEJZBJFYAR-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2F3O |
|---|---|
| Molecular weight | 257.03 g/mol |
| IUPAC name | 1-(2,4-dichloro-5-methylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | DKCAIEJZBJFYAR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)