Products 2764733-42-6
CAS 2764733-42-6 is the registry number for 3-(3-Bromo-5-methylphenyl)-3-hydroxy-N-methoxy-N-methylpropanamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-(3-bromo-5-methylphenyl)-3-hydroxy-N-methoxy-N-methylpropanamide (CAS 2764733-42-6) is a chemical compound with the molecular formula C12H16BrNO3 and a molecular weight of 302.16 g/mol. IUPAC name: 3-(3-bromo-5-methylphenyl)-3-hydroxy-N-methoxy-N-methylpropanamide. InChIKey: GXTNCAHUHOHRNJ-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO3 |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | 3-(3-bromo-5-methylphenyl)-3-hydroxy-N-methoxy-N-methylpropanamide |
| InChIKey | GXTNCAHUHOHRNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)C(CC(=O)N(C)OC)O |
Computed by PubChem (NCBI)