CAS 2764733-63-1 is the registry number for 1-Bromo-3-chloro-2-isopropoxy-5-(trifluoromethyl)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-3-chloro-2-propan-2-yloxy-5-(trifluoromethyl)benzene (CAS 2764733-63-1) is a chemical compound with the molecular formula C10H9BrClF3O and a molecular weight of 317.53 g/mol. IUPAC name: 1-bromo-3-chloro-2-propan-2-yloxy-5-(trifluoromethyl)benzene. InChIKey: BJKHFJRWCXJFLS-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClF3O |
|---|---|
| Molecular weight | 317.53 g/mol |
| IUPAC name | 1-bromo-3-chloro-2-propan-2-yloxy-5-(trifluoromethyl)benzene |
| InChIKey | BJKHFJRWCXJFLS-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Br)C(F)(F)F)Cl |
Computed by PubChem (NCBI)