Products 2764733-89-1
CAS 2764733-89-1 is the registry number for 4-Bromo-3-methoxy-4'-methyl-1,1'-biphenyl, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-2-methoxy-4-(4-methylphenyl)benzene (CAS 2764733-89-1) is a chemical compound with the molecular formula C14H13BrO and a molecular weight of 277.16 g/mol. IUPAC name: 1-bromo-2-methoxy-4-(4-methylphenyl)benzene. InChIKey: FTWPQZWLSPJSTP-UHFFFAOYSA-N.
| Molecular formula | C14H13BrO |
|---|---|
| Molecular weight | 277.16 g/mol |
| IUPAC name | 1-bromo-2-methoxy-4-(4-methylphenyl)benzene |
| InChIKey | FTWPQZWLSPJSTP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=C(C=C2)Br)OC |
Computed by PubChem (NCBI)