Products 2765-97-1
CAS 2765-97-1 appears in our catalog under these names: Pargeverine HCl, Propinox Hydrochloride, >95% (HPLC), Pargeverine hydrochloride, Pargeverine hcl, 95%, 95%, Pargeverine (hydrochloride). Offered by: Chemat Brand, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 250mg, 50mg, 10mg, 25mg, 500mg, 1g.
2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate;hydrochloride (CAS 2765-97-1) is a chemical compound with the molecular formula C21H24ClNO3 and a molecular weight of 373.9 g/mol. IUPAC name: 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate;hydrochloride. InChIKey: RSBGQTFIHFGTSY-UHFFFAOYSA-N.
| Molecular formula | C21H24ClNO3 |
|---|---|
| Molecular weight | 373.9 g/mol |
| IUPAC name | 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate;hydrochloride |
| InChIKey | RSBGQTFIHFGTSY-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)OCC#C.Cl |
Computed by PubChem (NCBI)