CAS 2765077-01-6 is the registry number for Methyl 6-iodochromane-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-iodo-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2765077-01-6) is a chemical compound with the molecular formula C11H11IO3 and a molecular weight of 318.11 g/mol. IUPAC name: methyl 6-iodo-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: HLMADZUIVCGRNP-UHFFFAOYSA-N.
| Molecular formula | C11H11IO3 |
|---|---|
| Molecular weight | 318.11 g/mol |
| IUPAC name | methyl 6-iodo-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | HLMADZUIVCGRNP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C=CC(=C2)I)OC1 |
Computed by PubChem (NCBI)