CAS 2765088-30-8 is the registry number for N-(5-Amino-1-methyl-1H-pyrazol-3-yl)-2,2,3,3,3-pentafluoropropanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-amino-1-methylpyrazol-3-yl)-2,2,3,3,3-pentafluoropropanamide (CAS 2765088-30-8) is a chemical compound with the molecular formula C7H7F5N4O and a molecular weight of 258.15 g/mol. IUPAC name: N-(5-amino-1-methylpyrazol-3-yl)-2,2,3,3,3-pentafluoropropanamide. InChIKey: AJINLLBLWWZFJV-UHFFFAOYSA-N.
| Molecular formula | C7H7F5N4O |
|---|---|
| Molecular weight | 258.15 g/mol |
| IUPAC name | N-(5-amino-1-methylpyrazol-3-yl)-2,2,3,3,3-pentafluoropropanamide |
| InChIKey | AJINLLBLWWZFJV-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)NC(=O)C(C(F)(F)F)(F)F)N |
Computed by PubChem (NCBI)