CAS 2765156-53-2 is the registry number for 6-Bromo-2-methyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-methyl-7-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 2765156-53-2) is a chemical compound with the molecular formula C9H5BrF3N3O and a molecular weight of 308.05 g/mol. IUPAC name: 6-bromo-2-methyl-7-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: YWTJXGPXFLYJEO-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3N3O |
|---|---|
| Molecular weight | 308.05 g/mol |
| IUPAC name | 6-bromo-2-methyl-7-(trifluoromethyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | YWTJXGPXFLYJEO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=C(C=C2C(=O)N1)Br)C(F)(F)F |
Computed by PubChem (NCBI)