CAS 2765255-93-2 appears in our catalog under these names: JNJ-28583113, 98%, JNJ-28583113, JNJ–28583113, JNJ-28583113 98%, JNJ-28583113, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10mM/1mL.
Ethyl 2-[3-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetate (CAS 2765255-93-2) is a chemical compound with the molecular formula C19H21F3N2O2 and a molecular weight of 366.4 g/mol. IUPAC name: ethyl 2-[3-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetate. InChIKey: WOERTJPEDOUEDS-UHFFFAOYSA-N.
| Molecular formula | C19H21F3N2O2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | ethyl 2-[3-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetate |
| InChIKey | WOERTJPEDOUEDS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C2=C(CCCCC2)C(=N1)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)