CAS 2765413-94-1 is the registry number for 4-Bromo-6-fluoro-5-iodo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
4-bromo-6-fluoro-5-iodo-1-(oxan-2-yl)indazole (CAS 2765413-94-1) is a chemical compound with the molecular formula C12H11BrFIN2O and a molecular weight of 425.03 g/mol. IUPAC name: 4-bromo-6-fluoro-5-iodo-1-(oxan-2-yl)indazole. InChIKey: DHICBPRPQVCVMK-UHFFFAOYSA-N.
| Molecular formula | C12H11BrFIN2O |
|---|---|
| Molecular weight | 425.03 g/mol |
| IUPAC name | 4-bromo-6-fluoro-5-iodo-1-(oxan-2-yl)indazole |
| InChIKey | DHICBPRPQVCVMK-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=CC(=C(C(=C3C=N2)Br)I)F |
Computed by PubChem (NCBI)