CAS 2765453-51-6 appears in our catalog under these names: TTBK1-IN-2/ 99.83% (existing batch purity), TTBK1–IN–2, TTBK1-IN-2, 99.91%, TTBK1-IN-2, 98%, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
N-[4-(4-chlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CAS 2765453-51-6) is a chemical compound with the molecular formula C18H13ClN4O and a molecular weight of 336.8 g/mol. IUPAC name: N-[4-(4-chlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: RWRSKMSFZCQDMQ-UHFFFAOYSA-N.
| Molecular formula | C18H13ClN4O |
|---|---|
| Molecular weight | 336.8 g/mol |
| IUPAC name | N-[4-(4-chlorophenoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | RWRSKMSFZCQDMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC=NC3=C2C=CN3)OC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)