CAS 27655-70-5 appears in our catalog under these names: Rel-(1S,6S)-bicyclo(4.2.0)octan-7-one, 98%, rac-(1R,6R)-Bicyclo(4.2.0)octan-7-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(1S,6S)-bicyclo[4.2.0]octan-7-one (CAS 27655-70-5) is a chemical compound with the molecular formula C8H12O and a molecular weight of 124.18 g/mol. IUPAC name: (1S,6S)-bicyclo[4.2.0]octan-7-one. InChIKey: SUIWRIPFUAFDJP-BQBZGAKWSA-N.
| Molecular formula | C8H12O |
|---|---|
| Molecular weight | 124.18 g/mol |
| IUPAC name | (1S,6S)-bicyclo[4.2.0]octan-7-one |
| InChIKey | SUIWRIPFUAFDJP-BQBZGAKWSA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)CC2=O |
Computed by PubChem (NCBI)