CAS 27655-95-4 appears in our catalog under these names: rac-5-Bromo Naproxen, >95% (HPLC), rac-5-Bromo Naproxen, Naproxen Impurity 48. Offered by: TRC, Chemat Brand, Biosynth. Available pack sizes: 2,5g, 250mg, on request, 5mg, 10mg, 25mg, 50mg.
2-(5-bromo-6-methoxynaphthalen-2-yl)propanoic acid (CAS 27655-95-4) is a chemical compound with the molecular formula C14H13BrO3 and a molecular weight of 309.15 g/mol. IUPAC name: 2-(5-bromo-6-methoxynaphthalen-2-yl)propanoic acid. InChIKey: JZRWXNBIQCMXSU-UHFFFAOYSA-N.
| Molecular formula | C14H13BrO3 |
|---|---|
| Molecular weight | 309.15 g/mol |
| IUPAC name | 2-(5-bromo-6-methoxynaphthalen-2-yl)propanoic acid |
| InChIKey | JZRWXNBIQCMXSU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C(=C(C=C2)OC)Br)C(=O)O |
Computed by PubChem (NCBI)