Products 2765562-60-3
CAS 2765562-60-3 is the registry number for (S)-N-(4,4'-Diamino-[1,1'-biphenyl]-2-yl)pyrrolidine-2-carboxamide, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(2S)-N-[5-amino-2-(4-aminophenyl)phenyl]pyrrolidine-2-carboxamide (CAS 2765562-60-3) is a chemical compound with the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. IUPAC name: (2S)-N-[5-amino-2-(4-aminophenyl)phenyl]pyrrolidine-2-carboxamide. InChIKey: NIALCOVGMFSFGV-HNNXBMFYSA-N.
| Molecular formula | C17H20N4O |
|---|---|
| Molecular weight | 296.37 g/mol |
| IUPAC name | (2S)-N-[5-amino-2-(4-aminophenyl)phenyl]pyrrolidine-2-carboxamide |
| InChIKey | NIALCOVGMFSFGV-HNNXBMFYSA-N |
| SMILES | C1C[C@H](NC1)C(=O)NC2=C(C=CC(=C2)N)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)