Products 27656-50-4
CAS 27656-50-4 is the registry number for (Z)-2,2,4,6,6-pentamethylhept-3-ene. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(Z)-2,2,4,6,6-pentamethylhept-3-ene (CAS 27656-50-4) is a chemical compound with the molecular formula C12H24 and a molecular weight of 168.32 g/mol. IUPAC name: (Z)-2,2,4,6,6-pentamethylhept-3-ene. InChIKey: NBUMCEJRJRRLCA-NTMALXAHSA-N.
| Molecular formula | C12H24 |
|---|---|
| Molecular weight | 168.32 g/mol |
| IUPAC name | (Z)-2,2,4,6,6-pentamethylhept-3-ene |
| InChIKey | NBUMCEJRJRRLCA-NTMALXAHSA-N |
| SMILES | C/C(=C/C(C)(C)C)/CC(C)(C)C |
Computed by PubChem (NCBI)