CAS 2765633-73-4 is the registry number for ALPK1–IN–3. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.
N-(4-ethynyl-1,3-benzothiazol-2-yl)-2,6-difluoro-4-piperazin-1-ylbenzamide (CAS 2765633-73-4) is a chemical compound with the molecular formula C20H16F2N4OS and a molecular weight of 398.4 g/mol. IUPAC name: N-(4-ethynyl-1,3-benzothiazol-2-yl)-2,6-difluoro-4-piperazin-1-ylbenzamide. InChIKey: SYFBCXSTGKUMAJ-UHFFFAOYSA-N.
| Molecular formula | C20H16F2N4OS |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | N-(4-ethynyl-1,3-benzothiazol-2-yl)-2,6-difluoro-4-piperazin-1-ylbenzamide |
| InChIKey | SYFBCXSTGKUMAJ-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C(=CC=C1)SC(=N2)NC(=O)C3=C(C=C(C=C3F)N4CCNCC4)F |
Computed by PubChem (NCBI)