Products 2766035-37-2
CAS 2766035-37-2 is the registry number for Antitumor agent-43. Offered by: MedChemExpress. Available pack sizes: Get quote.
14-nitro-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one (CAS 2766035-37-2) is a chemical compound with the molecular formula C16H8N2O3 and a molecular weight of 276.25 g/mol. IUPAC name: 14-nitro-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one. InChIKey: TTYSNERCQNXUTI-UHFFFAOYSA-N.
| Molecular formula | C16H8N2O3 |
|---|---|
| Molecular weight | 276.25 g/mol |
| IUPAC name | 14-nitro-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-8-one |
| InChIKey | TTYSNERCQNXUTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C(=C(C=C3)[N+](=O)[O-])C=CN=C4C2=O |
Computed by PubChem (NCBI)
Synonyms:
Antitumor agent-43