Products 2766214-15-5

CAS 2766214-15-5 is the registry number for Fmoc-Gly-Gly-allyl propionate, 96.90%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 50 mg, 25 mg, 100 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

(2R)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-oxo-5-prop-2-enoxypentanoic acid (CAS 2766214-15-5) is a chemical compound with the molecular formula C25H26N2O7 and a molecular weight of 466.5 g/mol. IUPAC name: (2R)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-oxo-5-prop-2-enoxypentanoic acid. InChIKey: CCNNYDKFKPLPIC-OAQYLSRUSA-N.

Identity
Molecular formulaC25H26N2O7
Molecular weight466.5 g/mol
IUPAC name(2R)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-5-oxo-5-prop-2-enoxypentanoic acid
InChIKeyCCNNYDKFKPLPIC-OAQYLSRUSA-N
SMILESC=CCOC(=O)CC[C@H](C(=O)O)NC(=O)CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)