CAS 27665-39-0 appears in our catalog under these names: 1,4-Butanedisulfonic Acid (contains ~40% water), >95% (HPLC), 1,4-Butanedisulfonic acid - 60% aqueous solution, Butane-1,4-disulfonic acid 98% (contains 30-40%H2O), Butane-1,4-disulfonic acid (Standard), Butane-1,4-disulfonic acid, 98%. Offered by: TRC, Biosynth, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 10g, 25g, 5g, 0,005kg, 0,01kg, 0,025kg, 0,05kg, 0,1kg.
Butane-1,4-disulfonic acid (CAS 27665-39-0) is a chemical compound with the molecular formula C4H10O6S2 and a molecular weight of 218.3 g/mol. IUPAC name: butane-1,4-disulfonic acid. InChIKey: VERAMNDAEAQRGS-UHFFFAOYSA-N.
| Molecular formula | C4H10O6S2 |
|---|---|
| Molecular weight | 218.3 g/mol |
| IUPAC name | butane-1,4-disulfonic acid |
| InChIKey | VERAMNDAEAQRGS-UHFFFAOYSA-N |
| SMILES | C(CCS(=O)(=O)O)CS(=O)(=O)O |
Computed by PubChem (NCBI)