Products 2766799-98-6
CAS 2766799-98-6 is the registry number for 2-(tert-Butyl) 3-methyl 5-chloro-6-methoxy-3,4-dihydroisoquinoline-2,3(1H)-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-tert-butyl 3-O-methyl 5-chloro-6-methoxy-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate (CAS 2766799-98-6) is a chemical compound with the molecular formula C17H22ClNO5 and a molecular weight of 355.8 g/mol. IUPAC name: 2-O-tert-butyl 3-O-methyl 5-chloro-6-methoxy-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate. InChIKey: RAUKYBDUKNTDPY-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO5 |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-methyl 5-chloro-6-methoxy-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate |
| InChIKey | RAUKYBDUKNTDPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(CC1C(=O)OC)C(=C(C=C2)OC)Cl |
Computed by PubChem (NCBI)