Products 2682114-30-1
CAS 2682114-30-1 is the registry number for Diethyl 2-acetamido-2-(2-chloro-4-methylbenzyl)malonate, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Diethyl 2-acetamido-2-[(2-chloro-4-methylphenyl)methyl]propanedioate (CAS 2682114-30-1) is a chemical compound with the molecular formula C17H22ClNO5 and a molecular weight of 355.8 g/mol. IUPAC name: diethyl 2-acetamido-2-[(2-chloro-4-methylphenyl)methyl]propanedioate. InChIKey: CTFCQVNSOVEAHD-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO5 |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | diethyl 2-acetamido-2-[(2-chloro-4-methylphenyl)methyl]propanedioate |
| InChIKey | CTFCQVNSOVEAHD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=C(C=C(C=C1)C)Cl)(C(=O)OCC)NC(=O)C |
Computed by PubChem (NCBI)