CAS 2766860-92-6 is the registry number for 1-(6-Fluoro-2-vinyl-(1-1-biphenyl)-3-yl)ethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g.
1-[3-(2-ethenylphenyl)-4-fluorophenyl]ethanone (CAS 2766860-92-6) is a chemical compound with the molecular formula C16H13FO and a molecular weight of 240.27 g/mol. IUPAC name: 1-[3-(2-ethenylphenyl)-4-fluorophenyl]ethanone. InChIKey: ZEXHLZDWYWLZOF-UHFFFAOYSA-N.
| Molecular formula | C16H13FO |
|---|---|
| Molecular weight | 240.27 g/mol |
| IUPAC name | 1-[3-(2-ethenylphenyl)-4-fluorophenyl]ethanone |
| InChIKey | ZEXHLZDWYWLZOF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)F)C2=CC=CC=C2C=C |
Computed by PubChem (NCBI)