Products 2767114-90-7
CAS 2767114-90-7 is the registry number for (S)-5-(4,4-Difluoropiperidin-3-yl)pyridin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(3S)-4,4-difluoropiperidin-3-yl]-1H-pyridin-2-one (CAS 2767114-90-7) is a chemical compound with the molecular formula C10H12F2N2O and a molecular weight of 214.21 g/mol. IUPAC name: 5-[(3S)-4,4-difluoropiperidin-3-yl]-1H-pyridin-2-one. InChIKey: HDGMGUOLBMDQRI-MRVPVSSYSA-N.
| Molecular formula | C10H12F2N2O |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 5-[(3S)-4,4-difluoropiperidin-3-yl]-1H-pyridin-2-one |
| InChIKey | HDGMGUOLBMDQRI-MRVPVSSYSA-N |
| SMILES | C1CNC[C@@H](C1(F)F)C2=CNC(=O)C=C2 |
Computed by PubChem (NCBI)