CAS 2767273-50-5 is the registry number for tert-Butyl (R)-(5,5-dimethylhex-1-yn-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3R)-5,5-dimethylhex-1-yn-3-yl]carbamate (CAS 2767273-50-5) is a chemical compound with the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. IUPAC name: tert-butyl N-[(3R)-5,5-dimethylhex-1-yn-3-yl]carbamate. InChIKey: DLAMIYJEUHLPNQ-JTQLQIEISA-N.
| Molecular formula | C13H23NO2 |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | tert-butyl N-[(3R)-5,5-dimethylhex-1-yn-3-yl]carbamate |
| InChIKey | DLAMIYJEUHLPNQ-JTQLQIEISA-N |
| SMILES | CC(C)(C)C[C@H](C#C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)