Products 2767446-34-2
CAS 2767446-34-2 is the registry number for Tubulin inhibitor 14. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-fluoro-3-(3-fluorophenyl)-2H-isoquinolin-1-one (CAS 2767446-34-2) is a chemical compound with the molecular formula C15H9F2NO and a molecular weight of 257.23 g/mol. IUPAC name: 6-fluoro-3-(3-fluorophenyl)-2H-isoquinolin-1-one. InChIKey: ALUOVSMIKCVEQC-UHFFFAOYSA-N.
| Molecular formula | C15H9F2NO |
|---|---|
| Molecular weight | 257.23 g/mol |
| IUPAC name | 6-fluoro-3-(3-fluorophenyl)-2H-isoquinolin-1-one |
| InChIKey | ALUOVSMIKCVEQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC3=C(C=CC(=C3)F)C(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
Tubulin inhibitor 14