Products 2767648-30-4
CAS 2767648-30-4 is the registry number for 1-(2,6-Dioxopiperidin-3-yl)-2-oxo-1,2-dihydrobenzo[cd]indole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-5-carboxylic acid (CAS 2767648-30-4) is a chemical compound with the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. IUPAC name: 1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-5-carboxylic acid. InChIKey: ZXVTXYHFBBYITL-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O5 |
|---|---|
| Molecular weight | 324.29 g/mol |
| IUPAC name | 1-(2,6-dioxopiperidin-3-yl)-2-oxobenzo[cd]indole-5-carboxylic acid |
| InChIKey | ZXVTXYHFBBYITL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C3=CC=CC4=C(C=CC(=C43)C2=O)C(=O)O |
Computed by PubChem (NCBI)