CAS 2767988-83-8 is the registry number for 2-Oxo-phentolamine. Offered by: TRC. Available pack sizes: 100mg.
N-(3-hydroxyphenyl)-N-(4-methylphenyl)-4,5-dihydro-1H-imidazole-2-carboxamide (CAS 2767988-83-8) is a chemical compound with the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. IUPAC name: N-(3-hydroxyphenyl)-N-(4-methylphenyl)-4,5-dihydro-1H-imidazole-2-carboxamide. InChIKey: SQFOAZDVHNHJBC-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O2 |
|---|---|
| Molecular weight | 295.34 g/mol |
| IUPAC name | N-(3-hydroxyphenyl)-N-(4-methylphenyl)-4,5-dihydro-1H-imidazole-2-carboxamide |
| InChIKey | SQFOAZDVHNHJBC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC(=CC=C2)O)C(=O)C3=NCCN3 |
Computed by PubChem (NCBI)