CAS 2768-90-3 appears in our catalog under these names: Pinacyanol chloride, 95%, Quinaldine Blue, Pinacyanol Chloride, >93.0%(HPLC), Quinolinium, 1-ethyl-2-[3-(1-ethyl-2(1H)-quinolinylidene)-1-propen-1-yl]-, chloride (1:1), Pinacyanol (chloride). Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 25mg, 250mg, Get quote.
(2E)-1-ethyl-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]quinoline chloride (CAS 2768-90-3) is a chemical compound with the molecular formula C25H25ClN2 and a molecular weight of 388.9 g/mol. IUPAC name: (2E)-1-ethyl-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]quinoline chloride. InChIKey: FVMNARAKYNRZID-UHFFFAOYSA-M.
| Molecular formula | C25H25ClN2 |
|---|---|
| Molecular weight | 388.9 g/mol |
| IUPAC name | (2E)-1-ethyl-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]quinoline chloride |
| InChIKey | FVMNARAKYNRZID-UHFFFAOYSA-M |
| SMILES | CCN1/C(=C/C=C/C2=[N+](C3=CC=CC=C3C=C2)CC)/C=CC4=CC=CC=C41.[Cl-] |
Computed by PubChem (NCBI)