CAS 2768004-68-6 is the registry number for Potassium trifluoro(1-methylazetidin-3-yl)borate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium trifluoro-(1-methylazetidin-3-yl)boranuide (CAS 2768004-68-6) is a chemical compound with the molecular formula C4H8BF3KN and a molecular weight of 177.02 g/mol. IUPAC name: potassium trifluoro-(1-methylazetidin-3-yl)boranuide. InChIKey: CRIAKAOIADEIBR-UHFFFAOYSA-N.
| Molecular formula | C4H8BF3KN |
|---|---|
| Molecular weight | 177.02 g/mol |
| IUPAC name | potassium trifluoro-(1-methylazetidin-3-yl)boranuide |
| InChIKey | CRIAKAOIADEIBR-UHFFFAOYSA-N |
| SMILES | [B-](C1CN(C1)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)