Products 2768029-03-2
CAS 2768029-03-2 is the registry number for TRPM5 agonist-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-1,2-benzothiazol-6-amine (CAS 2768029-03-2) is a chemical compound with the molecular formula C11H7Cl2N3S2 and a molecular weight of 316.2 g/mol. IUPAC name: 5-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-1,2-benzothiazol-6-amine. InChIKey: GFNMKESSHVFPQM-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2N3S2 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | 5-chloro-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-1,2-benzothiazol-6-amine |
| InChIKey | GFNMKESSHVFPQM-UHFFFAOYSA-N |
| SMILES | C1=C2C=NSC2=CC(=C1Cl)NCC3=NC=C(S3)Cl |
Computed by PubChem (NCBI)