Products 2768139-76-8
CAS 2768139-76-8 appears in our catalog under these names: ErSO–DFP, ErSO-DFP, 99.56%, ErSO-DFP, 99%, (R)-3-(4,4-Difluoropiperidin-1-Yl)-3-(4-Hydroxyphenyl)-7-(Trifluoromethyl)Indolin-2-One, 99%. Offered by: GLPBio, MedChemExpress, Ambeed, Chemat, BLDpharm. Available pack sizes: 10mg, 5mg, 25 mg, 10 mg, 100 mg, 5 mg, 50 mg, 100mg.
(3R)-3-(4,4-difluoropiperidin-1-yl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one (CAS 2768139-76-8) is a chemical compound with the molecular formula C20H17F5N2O2 and a molecular weight of 412.4 g/mol. IUPAC name: (3R)-3-(4,4-difluoropiperidin-1-yl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one. InChIKey: IVIIASPFEXRZGM-LJQANCHMSA-N.
| Molecular formula | C20H17F5N2O2 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | (3R)-3-(4,4-difluoropiperidin-1-yl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one |
| InChIKey | IVIIASPFEXRZGM-LJQANCHMSA-N |
| SMILES | C1CN(CCC1(F)F)[C@@]2(C3=C(C(=CC=C3)C(F)(F)F)NC2=O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)